About 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol
2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol (PubChem CID 170770730) has the molecular formula C10H8BrF3O
and a molecular weight of 281.07 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol |
| PubChem CID | 170770730 |
| Molecular Formula | C10H8BrF3O |
| Molecular Weight | 281.07 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol |
| SMILES | C=CC(O)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H8BrF3O/c1-2-9(15,10(12,13)14)7-3-5-8(11)6-4-7/h2-6,15H,1H2 |
| InChIKey | ILPYDCORKUAGDB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.07 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol?
The IUPAC name of 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol (CID 170770730) is 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol.
What is the SMILES notation for 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol?
The canonical SMILES for 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol is C=CC(O)(c1ccc(Br)cc1)C(F)(F)F.
What is the InChIKey of 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol?
The InChIKey is ILPYDCORKUAGDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF3O/c1-2-9(15,10(12,13)14)7-3-5-8(11)6-4-7/h2-6,15H,1H2.
What are the key properties of 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol?
2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol has a molecular weight of 281.07 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1,1,1-trifluorobut-3-en-2-ol is sourced from PubChem (CID 170770730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).