C9H6ClFN2O — CID 170771267
3-(4-chloro-3-fluorophenyl)-5-methyl-1,2,4-oxadiazole (PubChem CID 170771267) has the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenyl)-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-(4-chloro-3-fluorophenyl)-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 170771267 |
| Molecular Formula | C9H6ClFN2O |
| Molecular Weight | 212.61 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 3-(4-chloro-3-fluorophenyl)-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2ccc(Cl)c(F)c2)no1 |
| InChI | InChI=1S/C9H6ClFN2O/c1-5-12-9(13-14-5)6-2-3-7(10)8(11)4-6/h2-4H,1H3 |
| InChIKey | TUIIKCKWLGYPPW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |