C49H95NO4S — CID 170771323
[1-(6,6,8,8-tetramethylhexadecanoyloxy)-3-thiomorpholin-4-ylpropan-2-yl] 10,10,12,12-tetramethyloctadecanoate (PubChem CID 170771323) has the molecular formula C49H95NO4S and a molecular weight of 794.37 g/mol. Its IUPAC name is [1-(6,6,8,8-tetramethylhexadecanoyloxy)-3-thiomorpholin-4-ylpropan-2-yl] 10,10,12,12-tetramethyloctadecanoate.
| Compound Name | [1-(6,6,8,8-tetramethylhexadecanoyloxy)-3-thiomorpholin-4-ylpropan-2-yl] 10,10,12,12-tetramethyloctadecanoate |
|---|---|
| PubChem CID | 170771323 |
| Molecular Formula | C49H95NO4S |
| Molecular Weight | 794.37 g/mol |
| Exact Mass | 793.70 |
| IUPAC Name | [1-(6,6,8,8-tetramethylhexadecanoyloxy)-3-thiomorpholin-4-ylpropan-2-yl] 10,10,12,12-tetramethyloctadecanoate |
| SMILES | CCCCCCCCC(C)(C)CC(C)(C)CCCCC(=O)OCC(CN1CCSCC1)OC(=O)CCCCCCCCC(C)(C)CC(C)(C)CCCCCC |
| InChI | InChI=1S/C49H95NO4S/c1-11-13-15-17-21-26-32-48(7,8)42-49(9,10)34-28-24-29-44(51)53-40-43(39-50-35-37-55-38-36-50)54-45(52)30-23-20-18-19-22-27-33-47(5,6)41-46(3,4)31-25-16-14-12-2/h43H,11-42H2,1-10H3 |
| InChIKey | FUJXYPPQIBYXAE-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.37 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|