C33H31ClCmF3N6O2S- — CID 170771504
CID 170771504 (PubChem CID 170771504) has the molecular formula C33H31ClCmF3N6O2S- and a molecular weight of 915.16 g/mol.
| Compound Name | CID 170771504 |
|---|---|
| PubChem CID | 170771504 |
| Molecular Formula | C33H31ClCmF3N6O2S- |
| Molecular Weight | 915.16 g/mol |
| Exact Mass | 910.25 |
| IUPAC Name | — |
| SMILES | N#Cc1c(N)sc2c(F)ccc(-c3c(Cl)c4c5c(nc(OCC67CCCN6C[C@H](F)C7)nc5c3F)N3CCC[CH-]CC3CCO4)c12.[Cm] |
| InChI | InChI=1S/C33H31ClF3N6O2S.Cm/c34-25-23(19-6-7-21(36)29-22(19)20(14-38)30(39)46-29)26(37)27-24-28(25)44-12-8-18-5-2-1-3-11-43(18)31(24)41-32(40-27)45-16-33-9-4-10-42(33)15-17(35)13-33;/h2,6-7,17-18H,1,3-5,8-13,15-16,39H2;/q-1;/t17-,18?,33?;/m1./s1 |
| InChIKey | WSXLAYSMLYKCHD-ALPSPROYSA-N |
| XLogP | 7.20 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.16 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|