C12H13FN2S — CID 170772024
2-amino-5-fluoro-4-prop-1-en-2-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 170772024) has the molecular formula C12H13FN2S and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-amino-5-fluoro-4-prop-1-en-2-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-amino-5-fluoro-4-prop-1-en-2-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 170772024 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-amino-5-fluoro-4-prop-1-en-2-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | C=C(C)C1c2c(sc(N)c2C#N)CCC1F |
| InChI | InChI=1S/C12H13FN2S/c1-6(2)10-8(13)3-4-9-11(10)7(5-14)12(15)16-9/h8,10H,1,3-4,15H2,2H3 |
| InChIKey | BTTVZVAZUPCGLF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|