C26H18ClFN4O3S — CID 170772247
4-[6-(2-chloro-4-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]butanenitrile (PubChem CID 170772247) has the molecular formula C26H18ClFN4O3S and a molecular weight of 520.97 g/mol. Its IUPAC name is 4-[6-(2-chloro-4-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]butanenitrile.
| Compound Name | 4-[6-(2-chloro-4-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 170772247 |
| Molecular Formula | C26H18ClFN4O3S |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | 4-[6-(2-chloro-4-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]butanenitrile |
| SMILES | COc1cc(-c2cc3c(s2)c(=O)n(-c2cncc4ccccc24)c(=O)n3CCCC#N)c(Cl)cc1F |
| InChI | InChI=1S/C26H18ClFN4O3S/c1-35-22-10-17(18(27)11-19(22)28)23-12-20-24(36-23)25(33)32(26(34)31(20)9-5-4-8-29)21-14-30-13-15-6-2-3-7-16(15)21/h2-3,6-7,10-14H,4-5,9H2,1H3 |
| InChIKey | OXKCLDVMEVFPNL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|