C23H23ClN4O3S — CID 170772259
6-[(3Z)-2-chloro-5-methoxyhexa-1,3,5-trien-3-yl]-3-[(E)-2-(pyridin-3-ylmethylideneamino)ethenyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione;ethane (PubChem CID 170772259) has the molecular formula C23H23ClN4O3S and a molecular weight of 470.98 g/mol. Its IUPAC name is 6-[(3Z)-2-chloro-5-methoxyhexa-1,3,5-trien-3-yl]-3-[(E)-2-(pyridin-3-ylmethylideneamino)ethenyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione;ethane.
| Compound Name | 6-[(3Z)-2-chloro-5-methoxyhexa-1,3,5-trien-3-yl]-3-[(E)-2-(pyridin-3-ylmethylideneamino)ethenyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione;ethane |
|---|---|
| PubChem CID | 170772259 |
| Molecular Formula | C23H23ClN4O3S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 6-[(3Z)-2-chloro-5-methoxyhexa-1,3,5-trien-3-yl]-3-[(E)-2-(pyridin-3-ylmethylideneamino)ethenyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione;ethane |
| SMILES | C=C(/C=C(\C(=C)Cl)c1cc2[nH]c(=O)n(/C=C/N=C/c3cccnc3)c(=O)c2s1)OC.CC |
| InChI | InChI=1S/C21H17ClN4O3S.C2H6/c1-13(29-3)9-16(14(2)22)18-10-17-19(30-18)20(27)26(21(28)25-17)8-7-24-12-15-5-4-6-23-11-15;1-2/h4-12H,1-2H2,3H3,(H,25,28);1-2H3/b8-7+,16-9+,24-12+; |
| InChIKey | JDQRVVIDTRXMNM-XWSKODQBSA-N |
| XLogP | 5.02 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|