C21H14ClFN4O2S — CID 170772404
3-[6-(2-chlorophenyl)-3-(6-fluoro-5-methyl-3-pyridinyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]propanenitrile (PubChem CID 170772404) has the molecular formula C21H14ClFN4O2S and a molecular weight of 440.89 g/mol. Its IUPAC name is 3-[6-(2-chlorophenyl)-3-(6-fluoro-5-methyl-3-pyridinyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]propanenitrile.
| Compound Name | 3-[6-(2-chlorophenyl)-3-(6-fluoro-5-methyl-3-pyridinyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 170772404 |
| Molecular Formula | C21H14ClFN4O2S |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 3-[6-(2-chlorophenyl)-3-(6-fluoro-5-methyl-3-pyridinyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]propanenitrile |
| SMILES | Cc1cc(-n2c(=O)c3sc(-c4ccccc4Cl)cc3n(CCC#N)c2=O)cnc1F |
| InChI | InChI=1S/C21H14ClFN4O2S/c1-12-9-13(11-25-19(12)23)27-20(28)18-16(26(21(27)29)8-4-7-24)10-17(30-18)14-5-2-3-6-15(14)22/h2-3,5-6,9-11H,4,8H2,1H3 |
| InChIKey | HFTVSXUSPPKKGE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|