C22H15F2N5O3S — CID 170772757
(3E)-3-[1-(2-cyanoethyl)-3-[5-(difluoromethoxy)-3-pyridinyl]-2,4-dioxothieno[3,2-d]pyrimidin-6-yl]-2-methylidenehexa-3,5-dienenitrile (PubChem CID 170772757) has the molecular formula C22H15F2N5O3S and a molecular weight of 467.46 g/mol. Its IUPAC name is (3E)-3-[1-(2-cyanoethyl)-3-[5-(difluoromethoxy)-3-pyridinyl]-2,4-dioxothieno[3,2-d]pyrimidin-6-yl]-2-methylidenehexa-3,5-dienenitrile.
| Compound Name | (3E)-3-[1-(2-cyanoethyl)-3-[5-(difluoromethoxy)-3-pyridinyl]-2,4-dioxothieno[3,2-d]pyrimidin-6-yl]-2-methylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 170772757 |
| Molecular Formula | C22H15F2N5O3S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | (3E)-3-[1-(2-cyanoethyl)-3-[5-(difluoromethoxy)-3-pyridinyl]-2,4-dioxothieno[3,2-d]pyrimidin-6-yl]-2-methylidenehexa-3,5-dienenitrile |
| SMILES | C=C/C=C(\C(=C)C#N)c1cc2c(s1)c(=O)n(-c1cncc(OC(F)F)c1)c(=O)n2CCC#N |
| InChI | InChI=1S/C22H15F2N5O3S/c1-3-5-16(13(2)10-26)18-9-17-19(33-18)20(30)29(22(31)28(17)7-4-6-25)14-8-15(12-27-11-14)32-21(23)24/h3,5,8-9,11-12,21H,1-2,4,7H2/b16-5+ |
| InChIKey | MUQKPORUHRUFRO-FZSIALSZSA-N |
| XLogP | 3.77 |
| TPSA | 113.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|