C21H10Cl2FN3O2S — CID 170772838
6-(2,5-dichloro-4-fluorophenyl)-3-isoquinolin-4-yl-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 170772838) has the molecular formula C21H10Cl2FN3O2S and a molecular weight of 458.30 g/mol. Its IUPAC name is 6-(2,5-dichloro-4-fluorophenyl)-3-isoquinolin-4-yl-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2,5-dichloro-4-fluorophenyl)-3-isoquinolin-4-yl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170772838 |
| Molecular Formula | C21H10Cl2FN3O2S |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 456.99 |
| IUPAC Name | 6-(2,5-dichloro-4-fluorophenyl)-3-isoquinolin-4-yl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2cc(-c3cc(Cl)c(F)cc3Cl)sc2c(=O)n1-c1cncc2ccccc12 |
| InChI | InChI=1S/C21H10Cl2FN3O2S/c22-13-6-15(24)14(23)5-12(13)18-7-16-19(30-18)20(28)27(21(29)26-16)17-9-25-8-10-3-1-2-4-11(10)17/h1-9H,(H,26,29) |
| InChIKey | SJCMHJGOWVDUQJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|