About 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine
1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine (PubChem CID 170773220) has the molecular formula C10H11F2N3
and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine |
| PubChem CID | 170773220 |
| Molecular Formula | C10H11F2N3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine |
| SMILES | Cc1cncc2cnn(CC(C)(F)F)c12 |
| InChI | InChI=1S/C10H11F2N3/c1-7-3-13-4-8-5-14-15(9(7)8)6-10(2,11)12/h3-5H,6H2,1-2H3 |
| InChIKey | OXJWEECLHYDCSI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine?
The IUPAC name of 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine (CID 170773220) is 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine.
What is the SMILES notation for 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine?
The canonical SMILES for 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine is Cc1cncc2cnn(CC(C)(F)F)c12.
What is the InChIKey of 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine?
The InChIKey is OXJWEECLHYDCSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2N3/c1-7-3-13-4-8-5-14-15(9(7)8)6-10(2,11)12/h3-5H,6H2,1-2H3.
What are the key properties of 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine?
1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine has a molecular weight of 211.22 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoropropyl)-7-methylpyrazolo[4,5-c]pyridine is sourced from PubChem (CID 170773220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).