C24H16ClN3O2 — CID 170773275
7-(2-chlorophenyl)-3-(6-methylisoquinolin-4-yl)-1H-quinazoline-2,4-dione (PubChem CID 170773275) has the molecular formula C24H16ClN3O2 and a molecular weight of 413.86 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-3-(6-methylisoquinolin-4-yl)-1H-quinazoline-2,4-dione.
| Compound Name | 7-(2-chlorophenyl)-3-(6-methylisoquinolin-4-yl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 170773275 |
| Molecular Formula | C24H16ClN3O2 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 7-(2-chlorophenyl)-3-(6-methylisoquinolin-4-yl)-1H-quinazoline-2,4-dione |
| SMILES | Cc1ccc2cncc(-n3c(=O)[nH]c4cc(-c5ccccc5Cl)ccc4c3=O)c2c1 |
| InChI | InChI=1S/C24H16ClN3O2/c1-14-6-7-16-12-26-13-22(19(16)10-14)28-23(29)18-9-8-15(11-21(18)27-24(28)30)17-4-2-3-5-20(17)25/h2-13H,1H3,(H,27,30) |
| InChIKey | HAGBUHZKDGZNDB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |