C25H22N4O2S — CID 170773404
N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-1,6-naphthyridin-8-yl]-1,1-diphenylmethanimine (PubChem CID 170773404) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-1,6-naphthyridin-8-yl]-1,1-diphenylmethanimine.
| Compound Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-1,6-naphthyridin-8-yl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 170773404 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-1,6-naphthyridin-8-yl]-1,1-diphenylmethanimine |
| SMILES | O=S1(=O)CCN(c2ccc3cncc(N=C(c4ccccc4)c4ccccc4)c3n2)CC1 |
| InChI | InChI=1S/C25H22N4O2S/c30-32(31)15-13-29(14-16-32)23-12-11-21-17-26-18-22(25(21)28-23)27-24(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-12,17-18H,13-16H2 |
| InChIKey | CCUOXZDTKVQWHV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|