C4H4N6 — CID 170774084
[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-amine (PubChem CID 170774084) has the molecular formula C4H4N6 and a molecular weight of 136.12 g/mol. Its IUPAC name is [1,2,4]triazolo[5,1-c][1,2,4]triazin-3-amine.
| Compound Name | [1,2,4]triazolo[5,1-c][1,2,4]triazin-3-amine |
|---|---|
| PubChem CID | 170774084 |
| Molecular Formula | C4H4N6 |
| Molecular Weight | 136.12 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | [1,2,4]triazolo[5,1-c][1,2,4]triazin-3-amine |
| SMILES | Nc1cn2ncnc2nn1 |
| InChI | InChI=1S/C4H4N6/c5-3-1-10-4(9-8-3)6-2-7-10/h1-2H,5H2 |
| InChIKey | CVOYPVUUZWHSHC-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.12 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|