C20H19Cl3N2O4 — CID 170774124
ethyl 1-benzyl-3-(3,4,5-trichloro-2-nitrophenyl)pyrrolidine-3-carboxylate (PubChem CID 170774124) has the molecular formula C20H19Cl3N2O4 and a molecular weight of 457.74 g/mol. Its IUPAC name is ethyl 1-benzyl-3-(3,4,5-trichloro-2-nitrophenyl)pyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-benzyl-3-(3,4,5-trichloro-2-nitrophenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 170774124 |
| Molecular Formula | C20H19Cl3N2O4 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | ethyl 1-benzyl-3-(3,4,5-trichloro-2-nitrophenyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(c2cc(Cl)c(Cl)c(Cl)c2[N+](=O)[O-])CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H19Cl3N2O4/c1-2-29-19(26)20(8-9-24(12-20)11-13-6-4-3-5-7-13)14-10-15(21)16(22)17(23)18(14)25(27)28/h3-7,10H,2,8-9,11-12H2,1H3 |
| InChIKey | QPWYKWXOGDRJCD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|