C15H18N4O2S — CID 170774180
N-(4-methoxycyclohexyl)-6-(1,3-thiazol-5-yl)pyrazine-2-carboxamide (PubChem CID 170774180) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(4-methoxycyclohexyl)-6-(1,3-thiazol-5-yl)pyrazine-2-carboxamide.
| Compound Name | N-(4-methoxycyclohexyl)-6-(1,3-thiazol-5-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 170774180 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(4-methoxycyclohexyl)-6-(1,3-thiazol-5-yl)pyrazine-2-carboxamide |
| SMILES | COC1CCC(NC(=O)c2cncc(-c3cncs3)n2)CC1 |
| InChI | InChI=1S/C15H18N4O2S/c1-21-11-4-2-10(3-5-11)18-15(20)13-7-16-6-12(19-13)14-8-17-9-22-14/h6-11H,2-5H2,1H3,(H,18,20) |
| InChIKey | BJPOIXQDAMHWFM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |