C10H20N4O — CID 170774903
N,1-dimethyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide (PubChem CID 170774903) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is N,1-dimethyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N,1-dimethyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 170774903 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | N,1-dimethyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
| SMILES | CNC(=O)N1CCC2(CC1)CNCN2C |
| InChI | InChI=1S/C10H20N4O/c1-11-9(15)14-5-3-10(4-6-14)7-12-8-13(10)2/h12H,3-8H2,1-2H3,(H,11,15) |
| InChIKey | HTFJFWQHJHRPJC-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |