C12H18ClNOS — CID 170775212
(4aR,8aS)-4a-thiophen-2-yl-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride (PubChem CID 170775212) has the molecular formula C12H18ClNOS and a molecular weight of 259.80 g/mol. Its IUPAC name is (4aR,8aS)-4a-thiophen-2-yl-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride.
| Compound Name | (4aR,8aS)-4a-thiophen-2-yl-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride |
|---|---|
| PubChem CID | 170775212 |
| Molecular Formula | C12H18ClNOS |
| Molecular Weight | 259.80 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (4aR,8aS)-4a-thiophen-2-yl-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride |
| SMILES | Cl.c1csc([C@@]23CCCC[C@@H]2OCCN3)c1 |
| InChI | InChI=1S/C12H17NOS.ClH/c1-2-6-12(11-5-3-9-15-11)10(4-1)14-8-7-13-12;/h3,5,9-10,13H,1-2,4,6-8H2;1H/t10-,12+;/m0./s1 |
| InChIKey | GNOOWKCRCYEHRP-XOZOLZJESA-N |
| XLogP | 2.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |