C22H29N7O2S — CID 170775558
4-[4-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]piperazin-1-yl]-N,N,6-trimethyl-1,3,5-triazin-2-amine (PubChem CID 170775558) has the molecular formula C22H29N7O2S and a molecular weight of 455.59 g/mol. Its IUPAC name is 4-[4-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]piperazin-1-yl]-N,N,6-trimethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[4-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]piperazin-1-yl]-N,N,6-trimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 170775558 |
| Molecular Formula | C22H29N7O2S |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 4-[4-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]piperazin-1-yl]-N,N,6-trimethyl-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(-c2nc(CN3CCN(c4nc(C)nc(N(C)C)n4)CC3)cs2)cc1OC |
| InChI | InChI=1S/C22H29N7O2S/c1-15-23-21(27(2)3)26-22(24-15)29-10-8-28(9-11-29)13-17-14-32-20(25-17)16-6-7-18(30-4)19(12-16)31-5/h6-7,12,14H,8-11,13H2,1-5H3 |
| InChIKey | CAQIOXXKENUFRB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |