About 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate
3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate (PubChem CID 170776012) has the molecular formula C18H23NO5
and a molecular weight of 333.38 g/mol. Its IUPAC name is 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate |
| PubChem CID | 170776012 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(=O)n(C23CC(C2)C3)cc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23NO5/c1-5-23-15(21)12-6-14(20)19(18-7-11(8-18)9-18)10-13(12)16(22)24-17(2,3)4/h6,10-11H,5,7-9H2,1-4H3 |
| InChIKey | DKXXVQMUOHNIRI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate?
The IUPAC name of 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate (CID 170776012) is 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate.
What is the SMILES notation for 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate?
The canonical SMILES for 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate is CCOC(=O)c1cc(=O)n(C23CC(C2)C3)cc1C(=O)OC(C)(C)C.
What is the InChIKey of 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate?
The InChIKey is DKXXVQMUOHNIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO5/c1-5-23-15(21)12-6-14(20)19(18-7-11(8-18)9-18)10-13(12)16(22)24-17(2,3)4/h6,10-11H,5,7-9H2,1-4H3.
What are the key properties of 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate?
3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate has a molecular weight of 333.38 g/mol, XLogP of 2.49, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 4-O-ethyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxopyridine-3,4-dicarboxylate is sourced from PubChem (CID 170776012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).