About deuteriomethyl 2-(benzylamino)butanoate
deuteriomethyl 2-(benzylamino)butanoate (PubChem CID 170776143) has the molecular formula C12H17NO2
and a molecular weight of 208.28 g/mol. Its IUPAC name is deuteriomethyl 2-(benzylamino)butanoate.
Molecular Properties
| Compound Name | deuteriomethyl 2-(benzylamino)butanoate |
| PubChem CID | 170776143 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | deuteriomethyl 2-(benzylamino)butanoate |
| SMILES | [2H]COC(=O)C(CC)NCc1ccccc1 |
| InChI | InChI=1S/C12H17NO2/c1-3-11(12(14)15-2)13-9-10-7-5-4-6-8-10/h4-8,11,13H,3,9H2,1-2H3/i2D |
| InChIKey | VKXJALJQJXRIBP-VMNATFBRSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze deuteriomethyl 2-(benzylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethyl 2-(benzylamino)butanoate?
The IUPAC name of deuteriomethyl 2-(benzylamino)butanoate (CID 170776143) is deuteriomethyl 2-(benzylamino)butanoate.
What is the SMILES notation for deuteriomethyl 2-(benzylamino)butanoate?
The canonical SMILES for deuteriomethyl 2-(benzylamino)butanoate is [2H]COC(=O)C(CC)NCc1ccccc1.
What is the InChIKey of deuteriomethyl 2-(benzylamino)butanoate?
The InChIKey is VKXJALJQJXRIBP-VMNATFBRSA-N. The full InChI is InChI=1S/C12H17NO2/c1-3-11(12(14)15-2)13-9-10-7-5-4-6-8-10/h4-8,11,13H,3,9H2,1-2H3/i2D.
What are the key properties of deuteriomethyl 2-(benzylamino)butanoate?
deuteriomethyl 2-(benzylamino)butanoate has a molecular weight of 208.28 g/mol, XLogP of 1.73, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethyl 2-(benzylamino)butanoate is sourced from PubChem (CID 170776143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).