C22H20FNO — CID 170777206
4-(2,2-dimethylpropyl)-2-(7-fluorodibenzofuran-4-yl)pyridine (PubChem CID 170777206) has the molecular formula C22H20FNO and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-2-(7-fluorodibenzofuran-4-yl)pyridine.
| Compound Name | 4-(2,2-dimethylpropyl)-2-(7-fluorodibenzofuran-4-yl)pyridine |
|---|---|
| PubChem CID | 170777206 |
| Molecular Formula | C22H20FNO |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-2-(7-fluorodibenzofuran-4-yl)pyridine |
| SMILES | CC(C)(C)Cc1ccnc(-c2cccc3c2oc2cc(F)ccc23)c1 |
| InChI | InChI=1S/C22H20FNO/c1-22(2,3)13-14-9-10-24-19(11-14)18-6-4-5-17-16-8-7-15(23)12-20(16)25-21(17)18/h4-12H,13H2,1-3H3 |
| InChIKey | BPBHKNHFQZETLZ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |