About N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide
N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide (PubChem CID 170778488) has the molecular formula C7H5Cl2FN2O
and a molecular weight of 223.03 g/mol. Its IUPAC name is N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide.
Molecular Properties
| Compound Name | N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide |
| PubChem CID | 170778488 |
| Molecular Formula | C7H5Cl2FN2O |
| Molecular Weight | 223.03 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide |
| SMILES | CC(=O)Nc1nc(Cl)c(Cl)cc1F |
| InChI | InChI=1S/C7H5Cl2FN2O/c1-3(13)11-7-5(10)2-4(8)6(9)12-7/h2H,1H3,(H,11,12,13) |
| InChIKey | DFUULIMHLBXNLZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.03 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide?
The IUPAC name of N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide (CID 170778488) is N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide.
What is the SMILES notation for N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide?
The canonical SMILES for N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide is CC(=O)Nc1nc(Cl)c(Cl)cc1F.
What is the InChIKey of N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide?
The InChIKey is DFUULIMHLBXNLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2FN2O/c1-3(13)11-7-5(10)2-4(8)6(9)12-7/h2H,1H3,(H,11,12,13).
What are the key properties of N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide?
N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide has a molecular weight of 223.03 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dichloro-3-fluoro-2-pyridinyl)acetamide is sourced from PubChem (CID 170778488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).