C27H20N2O5 — CID 17078032
3-hydroxy-1-(naphthalen-2-ylmethyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]indol-2-one (PubChem CID 17078032) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is 3-hydroxy-1-(naphthalen-2-ylmethyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]indol-2-one.
| Compound Name | 3-hydroxy-1-(naphthalen-2-ylmethyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 17078032 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 3-hydroxy-1-(naphthalen-2-ylmethyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]indol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(Cc2ccc3ccccc3c2)c2ccccc21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H20N2O5/c30-25(20-11-13-22(14-12-20)29(33)34)16-27(32)23-7-3-4-8-24(23)28(26(27)31)17-18-9-10-19-5-1-2-6-21(19)15-18/h1-15,32H,16-17H2 |
| InChIKey | BDPCNFAWEMJQGJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|