About 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline
1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 170781987) has the molecular formula C18H19F2N
and a molecular weight of 287.35 g/mol. Its IUPAC name is 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 170781987 |
| Molecular Formula | C18H19F2N |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1ccc(N2CCc3ccccc3C2C(F)F)cc1C |
| InChI | InChI=1S/C18H19F2N/c1-12-7-8-15(11-13(12)2)21-10-9-14-5-3-4-6-16(14)17(21)18(19)20/h3-8,11,17-18H,9-10H2,1-2H3 |
| InChIKey | BWRUCXJCHPYGTF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline (CID 170781987) is 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline is Cc1ccc(N2CCc3ccccc3C2C(F)F)cc1C.
What is the InChIKey of 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline?
The InChIKey is BWRUCXJCHPYGTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F2N/c1-12-7-8-15(11-13(12)2)21-10-9-14-5-3-4-6-16(14)17(21)18(19)20/h3-8,11,17-18H,9-10H2,1-2H3.
What are the key properties of 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline?
1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline has a molecular weight of 287.35 g/mol, XLogP of 4.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-2-(3,4-dimethylphenyl)-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 170781987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).