C12H14F2O3S — CID 170782113
[(Z)-5-(3,5-difluorophenyl)pent-3-enyl] methanesulfonate (PubChem CID 170782113) has the molecular formula C12H14F2O3S and a molecular weight of 276.30 g/mol. Its IUPAC name is [(Z)-5-(3,5-difluorophenyl)pent-3-enyl] methanesulfonate.
| Compound Name | [(Z)-5-(3,5-difluorophenyl)pent-3-enyl] methanesulfonate |
|---|---|
| PubChem CID | 170782113 |
| Molecular Formula | C12H14F2O3S |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | [(Z)-5-(3,5-difluorophenyl)pent-3-enyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC/C=C\Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H14F2O3S/c1-18(15,16)17-6-4-2-3-5-10-7-11(13)9-12(14)8-10/h2-3,7-9H,4-6H2,1H3/b3-2- |
| InChIKey | QUJCYJITXRPNHM-IHWYPQMZSA-N |
| XLogP | 2.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|