About 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane
2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane (PubChem CID 170782328) has the molecular formula C9H11F2N
and a molecular weight of 171.19 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane |
| PubChem CID | 170782328 |
| Molecular Formula | C9H11F2N |
| Molecular Weight | 171.19 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane |
| SMILES | C#CC12CC(CN1CC(F)F)C2 |
| InChI | InChI=1S/C9H11F2N/c1-2-9-3-7(4-9)5-12(9)6-8(10)11/h1,7-8H,3-6H2 |
| InChIKey | BAAHHUQWKWBTCU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane?
The IUPAC name of 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane (CID 170782328) is 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane.
What is the SMILES notation for 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane?
The canonical SMILES for 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane is C#CC12CC(CN1CC(F)F)C2.
What is the InChIKey of 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane?
The InChIKey is BAAHHUQWKWBTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2N/c1-2-9-3-7(4-9)5-12(9)6-8(10)11/h1,7-8H,3-6H2.
What are the key properties of 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane?
2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane has a molecular weight of 171.19 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethyl)-1-ethynyl-2-azabicyclo[2.1.1]hexane is sourced from PubChem (CID 170782328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).