C32H28FN7O3S — CID 170782448
6-[4-[3-(benzenesulfonyl)propylamino]phenyl]-5-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 170782448) has the molecular formula C32H28FN7O3S and a molecular weight of 609.69 g/mol. Its IUPAC name is 6-[4-[3-(benzenesulfonyl)propylamino]phenyl]-5-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]pyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-[4-[3-(benzenesulfonyl)propylamino]phenyl]-5-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170782448 |
| Molecular Formula | C32H28FN7O3S |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | 6-[4-[3-(benzenesulfonyl)propylamino]phenyl]-5-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1ccnc(Oc2ccc(-n3c(-c4ccc(NCCCS(=O)(=O)c5ccccc5)cc4)cc4ncnc(N)c43)cc2F)n1 |
| InChI | InChI=1S/C32H28FN7O3S/c1-21-14-16-36-32(39-21)43-29-13-12-24(18-26(29)33)40-28(19-27-30(40)31(34)38-20-37-27)22-8-10-23(11-9-22)35-15-5-17-44(41,42)25-6-3-2-4-7-25/h2-4,6-14,16,18-20,35H,5,15,17H2,1H3,(H2,34,37,38) |
| InChIKey | XUNXSVDOYCAZOG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|