C22H29FN6O2 — CID 170782985
N-(cyclohexen-1-ylmethyl)-1-[4-(1,4-dimethylpyrazol-5-yl)-5-fluoropyrimidin-2-yl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 170782985) has the molecular formula C22H29FN6O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is N-(cyclohexen-1-ylmethyl)-1-[4-(1,4-dimethylpyrazol-5-yl)-5-fluoropyrimidin-2-yl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | N-(cyclohexen-1-ylmethyl)-1-[4-(1,4-dimethylpyrazol-5-yl)-5-fluoropyrimidin-2-yl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 170782985 |
| Molecular Formula | C22H29FN6O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-(cyclohexen-1-ylmethyl)-1-[4-(1,4-dimethylpyrazol-5-yl)-5-fluoropyrimidin-2-yl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | Cc1cnn(C)c1-c1nc(N2CCC(C(=O)N(O)CC3=CCCCC3)CC2)ncc1F |
| InChI | InChI=1S/C22H29FN6O2/c1-15-12-25-27(2)20(15)19-18(23)13-24-22(26-19)28-10-8-17(9-11-28)21(30)29(31)14-16-6-4-3-5-7-16/h6,12-13,17,31H,3-5,7-11,14H2,1-2H3 |
| InChIKey | FVILGWZQVQZALD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|