2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide

C12H23NO — CID 170783221

IUPAC2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide
SMILESCC(C)=CCCC(C)C=[N+]([O-])C(C)C
InChIInChI=1S/C12H23NO/c1-10(2)7-6-8-12(5)9-13(14)11(3)4/h7,9,11-12H,6,8H2,1-5H3
InChIKeyVBJUODUWVRJGOJ-UHFFFAOYSA-N
MW197.32 g/mol
LogP3.36
Rot. Bonds5

About 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide

2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide (PubChem CID 170783221) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide.

Molecular Properties

Compound Name2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide
PubChem CID170783221
Molecular FormulaC12H23NO
Molecular Weight197.32 g/mol
Exact Mass197.18
IUPAC Name2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide
SMILESCC(C)=CCCC(C)C=[N+]([O-])C(C)C
InChIInChI=1S/C12H23NO/c1-10(2)7-6-8-12(5)9-13(14)11(3)4/h7,9,11-12H,6,8H2,1-5H3
InChIKeyVBJUODUWVRJGOJ-UHFFFAOYSA-N
XLogP3.36
TPSA26.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.32
LogP ≤ 53.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide?
The IUPAC name of 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide (CID 170783221) is 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide.
What is the SMILES notation for 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide?
The canonical SMILES for 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide is CC(C)=CCCC(C)C=[N+]([O-])C(C)C.
What is the InChIKey of 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide?
The InChIKey is VBJUODUWVRJGOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-10(2)7-6-8-12(5)9-13(14)11(3)4/h7,9,11-12H,6,8H2,1-5H3.
What are the key properties of 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide?
2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide has a molecular weight of 197.32 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-N-propan-2-ylhept-5-en-1-imine oxide is sourced from PubChem (CID 170783221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).