C20H25F3GeO2S — CID 170783665
[1-(benzenesulfonyl)-6,6,6-trifluorohexyl]-dimethyl-phenylgermane (PubChem CID 170783665) has the molecular formula C20H25F3GeO2S and a molecular weight of 459.09 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-6,6,6-trifluorohexyl]-dimethyl-phenylgermane.
| Compound Name | [1-(benzenesulfonyl)-6,6,6-trifluorohexyl]-dimethyl-phenylgermane |
|---|---|
| PubChem CID | 170783665 |
| Molecular Formula | C20H25F3GeO2S |
| Molecular Weight | 459.09 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | [1-(benzenesulfonyl)-6,6,6-trifluorohexyl]-dimethyl-phenylgermane |
| SMILES | C[Ge](C)(c1ccccc1)C(CCCCC(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25F3GeO2S/c1-24(2,17-11-5-3-6-12-17)19(15-9-10-16-20(21,22)23)27(25,26)18-13-7-4-8-14-18/h3-8,11-14,19H,9-10,15-16H2,1-2H3 |
| InChIKey | KUQTVQZPJNGADS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.09 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|