C22H28N4S2 — CID 170783835
(6S)-6-N-[2-[1-(1-benzothiophen-4-yl)piperidin-4-yl]ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 170783835) has the molecular formula C22H28N4S2 and a molecular weight of 412.63 g/mol. Its IUPAC name is (6S)-6-N-[2-[1-(1-benzothiophen-4-yl)piperidin-4-yl]ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine.
| Compound Name | (6S)-6-N-[2-[1-(1-benzothiophen-4-yl)piperidin-4-yl]ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 170783835 |
| Molecular Formula | C22H28N4S2 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (6S)-6-N-[2-[1-(1-benzothiophen-4-yl)piperidin-4-yl]ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| SMILES | Nc1nc2c(s1)C[C@@H](NCCC1CCN(c3cccc4sccc34)CC1)CC2 |
| InChI | InChI=1S/C22H28N4S2/c23-22-25-18-5-4-16(14-21(18)28-22)24-10-6-15-7-11-26(12-8-15)19-2-1-3-20-17(19)9-13-27-20/h1-3,9,13,15-16,24H,4-8,10-12,14H2,(H2,23,25)/t16-/m0/s1 |
| InChIKey | GJCUHDDBTGOHTK-INIZCTEOSA-N |
| XLogP | 4.69 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |