About 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine
6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine (PubChem CID 170783971) has the molecular formula C12H12BrF3N4
and a molecular weight of 349.15 g/mol. Its IUPAC name is 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine |
| PubChem CID | 170783971 |
| Molecular Formula | C12H12BrF3N4 |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine |
| SMILES | Cc1nc2c(N3CCC(F)(F)CC3)nc(Br)cn2c1F |
| InChI | InChI=1S/C12H12BrF3N4/c1-7-9(14)20-6-8(13)18-10(11(20)17-7)19-4-2-12(15,16)3-5-19/h6H,2-5H2,1H3 |
| InChIKey | WUHYCFXCBATWTE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine?
The IUPAC name of 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine (CID 170783971) is 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine.
What is the SMILES notation for 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine?
The canonical SMILES for 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine is Cc1nc2c(N3CCC(F)(F)CC3)nc(Br)cn2c1F.
What is the InChIKey of 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine?
The InChIKey is WUHYCFXCBATWTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrF3N4/c1-7-9(14)20-6-8(13)18-10(11(20)17-7)19-4-2-12(15,16)3-5-19/h6H,2-5H2,1H3.
What are the key properties of 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine?
6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine has a molecular weight of 349.15 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-(4,4-difluoropiperidin-1-yl)-3-fluoro-2-methylimidazo[1,2-a]pyrazine is sourced from PubChem (CID 170783971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).