C35H41ClN4O3 — CID 170784216
3-[6-[[2-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170784216) has the molecular formula C35H41ClN4O3 and a molecular weight of 601.19 g/mol. Its IUPAC name is 3-[6-[[2-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[2-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170784216 |
| Molecular Formula | C35H41ClN4O3 |
| Molecular Weight | 601.19 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 3-[6-[[2-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1(C)CCC(CN2CC3CN(Cc4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)CC3C2)=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C35H41ClN4O3/c1-35(2)12-11-24(30(14-35)23-4-6-28(36)7-5-23)16-39-19-26-17-38(18-27(26)20-39)15-22-3-8-29-25(13-22)21-40(34(29)43)31-9-10-32(41)37-33(31)42/h3-8,13,26-27,31H,9-12,14-21H2,1-2H3,(H,37,41,42) |
| InChIKey | FNZDKTUXYHWKHB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|