C29H31N5O3 — CID 170784300
3-[3-oxo-6-[[4-[[4-(1H-pyrrol-2-yl)phenyl]methyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170784300) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is 3-[3-oxo-6-[[4-[[4-(1H-pyrrol-2-yl)phenyl]methyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[4-[[4-(1H-pyrrol-2-yl)phenyl]methyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170784300 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 3-[3-oxo-6-[[4-[[4-(1H-pyrrol-2-yl)phenyl]methyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CCN(Cc5ccc(-c6ccc[nH]6)cc5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H31N5O3/c35-27-10-9-26(28(36)31-27)34-19-23-16-21(5-8-24(23)29(34)37)18-33-14-12-32(13-15-33)17-20-3-6-22(7-4-20)25-2-1-11-30-25/h1-8,11,16,26,30H,9-10,12-15,17-19H2,(H,31,35,36) |
| InChIKey | QFICWJURWHGGJG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|