C20H24F3N5O3 — CID 170784866
(4aR,8aS)-6-[6-[[2-(trifluoromethyl)pyrimidin-5-yl]methyl]-2-azaspiro[3.3]heptane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 170784866) has the molecular formula C20H24F3N5O3 and a molecular weight of 439.44 g/mol. Its IUPAC name is (4aR,8aS)-6-[6-[[2-(trifluoromethyl)pyrimidin-5-yl]methyl]-2-azaspiro[3.3]heptane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR,8aS)-6-[6-[[2-(trifluoromethyl)pyrimidin-5-yl]methyl]-2-azaspiro[3.3]heptane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 170784866 |
| Molecular Formula | C20H24F3N5O3 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (4aR,8aS)-6-[6-[[2-(trifluoromethyl)pyrimidin-5-yl]methyl]-2-azaspiro[3.3]heptane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CC4(CC(Cc5cnc(C(F)(F)F)nc5)C4)C3)C[C@H]2N1 |
| InChI | InChI=1S/C20H24F3N5O3/c21-20(22,23)17-24-6-13(7-25-17)3-12-4-19(5-12)10-28(11-19)18(30)27-2-1-15-14(8-27)26-16(29)9-31-15/h6-7,12,14-15H,1-5,8-11H2,(H,26,29)/t14-,15+/m1/s1 |
| InChIKey | GUKMTIFUMNTKDC-CABCVRRESA-N |
| XLogP | 1.46 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |