About ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane
ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane (PubChem CID 170785783) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane.
Molecular Properties
| Compound Name | ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane |
| PubChem CID | 170785783 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane |
| SMILES | C.C=C/C=C1C(=C/C)\CNCN\1C(C)C.CC |
| InChI | InChI=1S/C12H20N2.C2H6.CH4/c1-5-7-12-11(6-2)8-13-9-14(12)10(3)4;1-2;/h5-7,10,13H,1,8-9H2,2-4H3;1-2H3;1H4/b11-6-,12-7+;; |
| InChIKey | SKGSSBNMTZOYIT-NWZOJWINSA-N |
| XLogP | 3.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane?
The IUPAC name of ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane (CID 170785783) is ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane.
What is the SMILES notation for ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane?
The canonical SMILES for ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane is C.C=C/C=C1C(=C/C)\CNCN\1C(C)C.CC.
What is the InChIKey of ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane?
The InChIKey is SKGSSBNMTZOYIT-NWZOJWINSA-N. The full InChI is InChI=1S/C12H20N2.C2H6.CH4/c1-5-7-12-11(6-2)8-13-9-14(12)10(3)4;1-2;/h5-7,10,13H,1,8-9H2,2-4H3;1-2H3;1H4/b11-6-,12-7+;;.
What are the key properties of ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane?
ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane has a molecular weight of 238.42 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(5Z,6E)-5-ethylidene-1-propan-2-yl-6-prop-2-enylidene-1,3-diazinane;methane is sourced from PubChem (CID 170785783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).