About 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide
1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide (PubChem CID 170786322) has the molecular formula C16H22F2N2O
and a molecular weight of 296.36 g/mol. Its IUPAC name is 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide |
| PubChem CID | 170786322 |
| Molecular Formula | C16H22F2N2O |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1ccc(C)cc1.CC(=O)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H12N2.C7H10F2O/c1-7-3-5-8(6-4-7)9(10)11-2;1-5(10)6-2-3-7(8,9)4-6/h3-6H,1-2H3,(H2,10,11);6H,2-4H2,1H3 |
| InChIKey | REJSEJNSIMORRO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide?
The IUPAC name of 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide (CID 170786322) is 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide.
What is the SMILES notation for 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide?
The canonical SMILES for 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide is C/N=C(\N)c1ccc(C)cc1.CC(=O)C1CCC(F)(F)C1.
What is the InChIKey of 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide?
The InChIKey is REJSEJNSIMORRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.C7H10F2O/c1-7-3-5-8(6-4-7)9(10)11-2;1-5(10)6-2-3-7(8,9)4-6/h3-6H,1-2H3,(H2,10,11);6H,2-4H2,1H3.
What are the key properties of 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide?
1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide has a molecular weight of 296.36 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluorocyclopentyl)ethanone;N',4-dimethylbenzenecarboximidamide is sourced from PubChem (CID 170786322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).