C25H21F6N5O3 — CID 170786676
3-amino-5,5,7-trifluoro-8-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[[4-[(E)-C-methyl-N-(3,3,3-trifluoroprop-1-en-2-yloxy)carbonimidoyl]phenyl]methyl]-3,4-dihydro-1-benzazepin-2-one (PubChem CID 170786676) has the molecular formula C25H21F6N5O3 and a molecular weight of 553.46 g/mol. Its IUPAC name is 3-amino-5,5,7-trifluoro-8-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[[4-[(E)-C-methyl-N-(3,3,3-trifluoroprop-1-en-2-yloxy)carbonimidoyl]phenyl]methyl]-3,4-dihydro-1-benzazepin-2-one.
| Compound Name | 3-amino-5,5,7-trifluoro-8-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[[4-[(E)-C-methyl-N-(3,3,3-trifluoroprop-1-en-2-yloxy)carbonimidoyl]phenyl]methyl]-3,4-dihydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 170786676 |
| Molecular Formula | C25H21F6N5O3 |
| Molecular Weight | 553.46 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 3-amino-5,5,7-trifluoro-8-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[[4-[(E)-C-methyl-N-(3,3,3-trifluoroprop-1-en-2-yloxy)carbonimidoyl]phenyl]methyl]-3,4-dihydro-1-benzazepin-2-one |
| SMILES | C=C(O/N=C(\C)c1ccc(CN2C(=O)C(N)CC(F)(F)c3cc(F)c(-c4nnc(C)o4)cc32)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H21F6N5O3/c1-12(35-39-13(2)25(29,30)31)16-6-4-15(5-7-16)11-36-21-8-17(22-34-33-14(3)38-22)19(26)9-18(21)24(27,28)10-20(32)23(36)37/h4-9,20H,2,10-11,32H2,1,3H3/b35-12+ |
| InChIKey | GFIIJKIXBANSCX-RHQFVSDJSA-N |
| XLogP | 5.36 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|