C24H21N5O2S — CID 17078713
6-(4-methoxyphenyl)-N,3-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 17078713) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-N,3-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | 6-(4-methoxyphenyl)-N,3-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 17078713 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 6-(4-methoxyphenyl)-N,3-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | COc1ccc(C2Nn3c(nnc3-c3ccccc3)SC2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N5O2S/c1-31-19-14-12-16(13-15-19)20-21(23(30)25-18-10-6-3-7-11-18)32-24-27-26-22(29(24)28-20)17-8-4-2-5-9-17/h2-15,20-21,28H,1H3,(H,25,30) |
| InChIKey | GWYQDUWXMQMADR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |