C13H23NO — CID 170787386
2-cyclohexyl-1-(3,3-dimethylazetidin-1-yl)ethanone (PubChem CID 170787386) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2-cyclohexyl-1-(3,3-dimethylazetidin-1-yl)ethanone.
| Compound Name | 2-cyclohexyl-1-(3,3-dimethylazetidin-1-yl)ethanone |
|---|---|
| PubChem CID | 170787386 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-cyclohexyl-1-(3,3-dimethylazetidin-1-yl)ethanone |
| SMILES | CC1(C)CN(C(=O)CC2CCCCC2)C1 |
| InChI | InChI=1S/C13H23NO/c1-13(2)9-14(10-13)12(15)8-11-6-4-3-5-7-11/h11H,3-10H2,1-2H3 |
| InChIKey | VXMUYJBPDHMBQY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |