C20H22Br2F2N2O — CID 170787906
(2,6-dibromo-4-octoxyphenyl)-(2,6-difluorophenyl)diazene (PubChem CID 170787906) has the molecular formula C20H22Br2F2N2O and a molecular weight of 504.21 g/mol. Its IUPAC name is (2,6-dibromo-4-octoxyphenyl)-(2,6-difluorophenyl)diazene.
| Compound Name | (2,6-dibromo-4-octoxyphenyl)-(2,6-difluorophenyl)diazene |
|---|---|
| PubChem CID | 170787906 |
| Molecular Formula | C20H22Br2F2N2O |
| Molecular Weight | 504.21 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | (2,6-dibromo-4-octoxyphenyl)-(2,6-difluorophenyl)diazene |
| SMILES | CCCCCCCCOc1cc(Br)c(/N=N/c2c(F)cccc2F)c(Br)c1 |
| InChI | InChI=1S/C20H22Br2F2N2O/c1-2-3-4-5-6-7-11-27-14-12-15(21)19(16(22)13-14)25-26-20-17(23)9-8-10-18(20)24/h8-10,12-13H,2-7,11H2,1H3/b26-25+ |
| InChIKey | FGKLVTLNJWSJBE-OCEACIFDSA-N |
| XLogP | 8.64 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.21 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|