C27H21NO6S2 — CID 170788133
2-(3-methylphenyl)sulfanylbenzoic acid;2-(4-nitrophenyl)sulfanylbenzoic acid (PubChem CID 170788133) has the molecular formula C27H21NO6S2 and a molecular weight of 519.60 g/mol. Its IUPAC name is 2-(3-methylphenyl)sulfanylbenzoic acid;2-(4-nitrophenyl)sulfanylbenzoic acid.
| Compound Name | 2-(3-methylphenyl)sulfanylbenzoic acid;2-(4-nitrophenyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 170788133 |
| Molecular Formula | C27H21NO6S2 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | 2-(3-methylphenyl)sulfanylbenzoic acid;2-(4-nitrophenyl)sulfanylbenzoic acid |
| SMILES | Cc1cccc(Sc2ccccc2C(=O)O)c1.O=C(O)c1ccccc1Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H12O2S.C13H9NO4S/c1-10-5-4-6-11(9-10)17-13-8-3-2-7-12(13)14(15)16;15-13(16)11-3-1-2-4-12(11)19-10-7-5-9(6-8-10)14(17)18/h2-9H,1H3,(H,15,16);1-8H,(H,15,16) |
| InChIKey | CBSMHZLAJUIRKE-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|