About 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one
6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 170788989) has the molecular formula C13H18FN5O
and a molecular weight of 279.32 g/mol. Its IUPAC name is 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one |
| PubChem CID | 170788989 |
| Molecular Formula | C13H18FN5O |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CNC1CCN(c2cnc3[nH]c(=O)n(C)c3c2)CC1F |
| InChI | InChI=1S/C13H18FN5O/c1-15-10-3-4-19(7-9(10)14)8-5-11-12(16-6-8)17-13(20)18(11)2/h5-6,9-10,15H,3-4,7H2,1-2H3,(H,16,17,20) |
| InChIKey | UGXUXBNDOUMDFX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one?
The IUPAC name of 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one (CID 170788989) is 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one is CNC1CCN(c2cnc3[nH]c(=O)n(C)c3c2)CC1F.
What is the InChIKey of 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one?
The InChIKey is UGXUXBNDOUMDFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN5O/c1-15-10-3-4-19(7-9(10)14)8-5-11-12(16-6-8)17-13(20)18(11)2/h5-6,9-10,15H,3-4,7H2,1-2H3,(H,16,17,20).
What are the key properties of 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one?
6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one has a molecular weight of 279.32 g/mol, XLogP of 0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-fluoro-4-(methylamino)piperidin-1-yl]-1-methyl-3H-imidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 170788989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).