C18H19NO2S — CID 170789345
(NE,S)-N-(1-dibenzofuran-2-ylethylidene)-2-methylpropane-2-sulfinamide (PubChem CID 170789345) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is (NE,S)-N-(1-dibenzofuran-2-ylethylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-(1-dibenzofuran-2-ylethylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 170789345 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (NE,S)-N-(1-dibenzofuran-2-ylethylidene)-2-methylpropane-2-sulfinamide |
| SMILES | C/C(=N\[S@@](=O)C(C)(C)C)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C18H19NO2S/c1-12(19-22(20)18(2,3)4)13-9-10-17-15(11-13)14-7-5-6-8-16(14)21-17/h5-11H,1-4H3/b19-12+/t22-/m0/s1 |
| InChIKey | LPIIFYSTSBPOSC-PSXBWXLBSA-N |
| XLogP | 4.86 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|