C31H38N2O5 — CID 17078974
CID 17078974 (PubChem CID 17078974) has the molecular formula C31H38N2O5 and a molecular weight of 518.65 g/mol.
| Compound Name | CID 17078974 |
|---|---|
| PubChem CID | 17078974 |
| Molecular Formula | C31H38N2O5 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1=C(N)OC2=C(C(=O)CC(C)(C)C2)C12C(=O)N1c3c(cccc32)C(C)(C)CC12CCCCC2 |
| InChI | InChI=1S/C31H38N2O5/c1-6-37-26(35)23-25(32)38-21-16-28(2,3)15-20(34)22(21)31(23)19-12-10-11-18-24(19)33(27(31)36)30(17-29(18,4)5)13-8-7-9-14-30/h10-12H,6-9,13-17,32H2,1-5H3 |
| InChIKey | FUKZNXVPCKDMRS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |