About CID 17078974
CID 17078974 (PubChem CID 17078974) has the molecular formula C31H38N2O5
and a molecular weight of 518.65 g/mol.
Molecular Properties
| Compound Name | CID 17078974 |
| PubChem CID | 17078974 |
| Molecular Formula | C31H38N2O5 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1=C(N)OC2=C(C(=O)CC(C)(C)C2)C12C(=O)N1c3c(cccc32)C(C)(C)CC12CCCCC2 |
| InChI | InChI=1S/C31H38N2O5/c1-6-37-26(35)23-25(32)38-21-16-28(2,3)15-20(34)22(21)31(23)19-12-10-11-18-24(19)33(27(31)36)30(17-29(18,4)5)13-8-7-9-14-30/h10-12H,6-9,13-17,32H2,1-5H3 |
| InChIKey | FUKZNXVPCKDMRS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 17078974 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 17078974?
The IUPAC name of CID 17078974 (CID 17078974) is not available.
What is the SMILES notation for CID 17078974?
The canonical SMILES for CID 17078974 is CCOC(=O)C1=C(N)OC2=C(C(=O)CC(C)(C)C2)C12C(=O)N1c3c(cccc32)C(C)(C)CC12CCCCC2.
What is the InChIKey of CID 17078974?
The InChIKey is FUKZNXVPCKDMRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H38N2O5/c1-6-37-26(35)23-25(32)38-21-16-28(2,3)15-20(34)22(21)31(23)19-12-10-11-18-24(19)33(27(31)36)30(17-29(18,4)5)13-8-7-9-14-30/h10-12H,6-9,13-17,32H2,1-5H3.
What are the key properties of CID 17078974?
CID 17078974 has a molecular weight of 518.65 g/mol, XLogP of 5.06, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 17078974 is sourced from PubChem (CID 17078974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).