C8H13N3O3 — CID 170789910
methyl 2-[[(E)-2-amino-3-(ethylideneamino)prop-2-enoyl]amino]acetate (PubChem CID 170789910) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is methyl 2-[[(E)-2-amino-3-(ethylideneamino)prop-2-enoyl]amino]acetate.
| Compound Name | methyl 2-[[(E)-2-amino-3-(ethylideneamino)prop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 170789910 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | methyl 2-[[(E)-2-amino-3-(ethylideneamino)prop-2-enoyl]amino]acetate |
| SMILES | C/C=N/C=C(/N)C(=O)NCC(=O)OC |
| InChI | InChI=1S/C8H13N3O3/c1-3-10-4-6(9)8(13)11-5-7(12)14-2/h3-4H,5,9H2,1-2H3,(H,11,13)/b6-4+,10-3+ |
| InChIKey | ZGUVEKNHCHKROV-NQTSTVBXSA-N |
| XLogP | -0.83 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|