C14H14N2O4 — CID 170790780
[6-methyl-3-[2-(methylamino)-2-oxoacetyl]-1H-indol-4-yl] acetate (PubChem CID 170790780) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is [6-methyl-3-[2-(methylamino)-2-oxoacetyl]-1H-indol-4-yl] acetate.
| Compound Name | [6-methyl-3-[2-(methylamino)-2-oxoacetyl]-1H-indol-4-yl] acetate |
|---|---|
| PubChem CID | 170790780 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [6-methyl-3-[2-(methylamino)-2-oxoacetyl]-1H-indol-4-yl] acetate |
| SMILES | CNC(=O)C(=O)c1c[nH]c2cc(C)cc(OC(C)=O)c12 |
| InChI | InChI=1S/C14H14N2O4/c1-7-4-10-12(11(5-7)20-8(2)17)9(6-16-10)13(18)14(19)15-3/h4-6,16H,1-3H3,(H,15,19) |
| InChIKey | DJDNZOMMMNDGGN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|