About 1-methyltetrazole-5-thiolate;tungsten
1-methyltetrazole-5-thiolate;tungsten (PubChem CID 170791029) has the molecular formula C2H3N4SW-
and a molecular weight of 298.98 g/mol. Its IUPAC name is 1-methyltetrazole-5-thiolate;tungsten.
Molecular Properties
| Compound Name | 1-methyltetrazole-5-thiolate;tungsten |
| PubChem CID | 170791029 |
| Molecular Formula | C2H3N4SW- |
| Molecular Weight | 298.98 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | 1-methyltetrazole-5-thiolate;tungsten |
| SMILES | Cn1nnnc1[S-].[W] |
| InChI | InChI=1S/C2H4N4S.W/c1-6-2(7)3-4-5-6;/h1H3,(H,3,5,7);/p-1 |
| InChIKey | ATJLRGSNRRULQH-UHFFFAOYSA-M |
| XLogP | -0.89 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.98 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyltetrazole-5-thiolate;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyltetrazole-5-thiolate;tungsten?
The IUPAC name of 1-methyltetrazole-5-thiolate;tungsten (CID 170791029) is 1-methyltetrazole-5-thiolate;tungsten.
What is the SMILES notation for 1-methyltetrazole-5-thiolate;tungsten?
The canonical SMILES for 1-methyltetrazole-5-thiolate;tungsten is Cn1nnnc1[S-].[W].
What is the InChIKey of 1-methyltetrazole-5-thiolate;tungsten?
The InChIKey is ATJLRGSNRRULQH-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4N4S.W/c1-6-2(7)3-4-5-6;/h1H3,(H,3,5,7);/p-1.
What are the key properties of 1-methyltetrazole-5-thiolate;tungsten?
1-methyltetrazole-5-thiolate;tungsten has a molecular weight of 298.98 g/mol, XLogP of -0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyltetrazole-5-thiolate;tungsten is sourced from PubChem (CID 170791029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).