C28H31B2FN8O3 — CID 170791982
CID 170791982 (PubChem CID 170791982) has the molecular formula C28H31B2FN8O3 and a molecular weight of 568.23 g/mol.
| Compound Name | CID 170791982 |
|---|---|
| PubChem CID | 170791982 |
| Molecular Formula | C28H31B2FN8O3 |
| Molecular Weight | 568.23 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C)n1ncc2c1-c1cnc(NCOC(=O)C(N)C(C)C)c(c1)O[C@H](C)c1cc(F)ccc1-c1nn(C)nc1C2 |
| InChI | InChI=1S/C28H31B2FN8O3/c1-14(2)23(32)27(40)41-13-34-26-22-9-17(11-33-26)25-16(12-35-39(25)28(4,29)30)8-21-24(37-38(5)36-21)19-7-6-18(31)10-20(19)15(3)42-22/h6-7,9-12,14-15,23H,8,13,32H2,1-5H3,(H,33,34)/t15-,23?/m1/s1 |
| InChIKey | OQDKXPUOIXPOOW-NKTHEXPSSA-N |
| XLogP | 2.79 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|